C22H31N3O4 — CID 98246454
(2S)-2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-(4-hydroxycyclohexyl)-2-phenylacetamide (PubChem CID 98246454) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2S)-2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-(4-hydroxycyclohexyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-(4-hydroxycyclohexyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 98246454 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | (2S)-2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-(4-hydroxycyclohexyl)-2-phenylacetamide |
| SMILES | CCCCN1CCN([C@H](C(=O)NC2CCC(O)CC2)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C22H31N3O4/c1-2-3-13-24-14-15-25(22(29)21(24)28)19(16-7-5-4-6-8-16)20(27)23-17-9-11-18(26)12-10-17/h4-8,17-19,26H,2-3,9-15H2,1H3,(H,23,27)/t17?,18?,19-/m0/s1 |
| InChIKey | CXLPBVHFQMVDMT-ACBHZAAOSA-N |
| XLogP | 1.62 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|