C23H33N3O3 — CID 70731262
2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-cycloheptyl-2-phenylacetamide (PubChem CID 70731262) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-cycloheptyl-2-phenylacetamide.
| Compound Name | 2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-cycloheptyl-2-phenylacetamide |
|---|---|
| PubChem CID | 70731262 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 2-(4-butyl-2,3-dioxopiperazin-1-yl)-N-cycloheptyl-2-phenylacetamide |
| SMILES | CCCCN1CCN(C(C(=O)NC2CCCCCC2)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C23H33N3O3/c1-2-3-15-25-16-17-26(23(29)22(25)28)20(18-11-7-6-8-12-18)21(27)24-19-13-9-4-5-10-14-19/h6-8,11-12,19-20H,2-5,9-10,13-17H2,1H3,(H,24,27) |
| InChIKey | JNNYOVFTXUXDJS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|