C21H32N2O — CID 94778967
(2S)-N-cyclohexyl-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-phenylacetamide (PubChem CID 94778967) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-phenylacetamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 94778967 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-2-phenylacetamide |
| SMILES | C[C@@H]1C[C@@H](C)CN([C@H](C(=O)NC2CCCCC2)c2ccccc2)C1 |
| InChI | InChI=1S/C21H32N2O/c1-16-13-17(2)15-23(14-16)20(18-9-5-3-6-10-18)21(24)22-19-11-7-4-8-12-19/h3,5-6,9-10,16-17,19-20H,4,7-8,11-15H2,1-2H3,(H,22,24)/t16-,17-,20+/m1/s1 |
| InChIKey | VXGAVIRQFRIIMO-HLIPFELVSA-N |
| XLogP | 4.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |