C15H23N3O — CID 63568815
2-(3,5-dimethylpiperidin-1-yl)-2-phenylacetohydrazide (PubChem CID 63568815) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-(3,5-dimethylpiperidin-1-yl)-2-phenylacetohydrazide.
| Compound Name | 2-(3,5-dimethylpiperidin-1-yl)-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 63568815 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 2-(3,5-dimethylpiperidin-1-yl)-2-phenylacetohydrazide |
| SMILES | CC1CC(C)CN(C(C(=O)NN)c2ccccc2)C1 |
| InChI | InChI=1S/C15H23N3O/c1-11-8-12(2)10-18(9-11)14(15(19)17-16)13-6-4-3-5-7-13/h3-7,11-12,14H,8-10,16H2,1-2H3,(H,17,19) |
| InChIKey | KBRFGLUDLQYRMS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|