C23H36N2O — CID 51361418
N-cyclohexyl-2-(3,5-dimethylpiperidin-1-yl)-4-phenylbutanamide (PubChem CID 51361418) has the molecular formula C23H36N2O and a molecular weight of 356.55 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,5-dimethylpiperidin-1-yl)-4-phenylbutanamide.
| Compound Name | N-cyclohexyl-2-(3,5-dimethylpiperidin-1-yl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 51361418 |
| Molecular Formula | C23H36N2O |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | N-cyclohexyl-2-(3,5-dimethylpiperidin-1-yl)-4-phenylbutanamide |
| SMILES | CC1CC(C)CN(C(CCc2ccccc2)C(=O)NC2CCCCC2)C1 |
| InChI | InChI=1S/C23H36N2O/c1-18-15-19(2)17-25(16-18)22(14-13-20-9-5-3-6-10-20)23(26)24-21-11-7-4-8-12-21/h3,5-6,9-10,18-19,21-22H,4,7-8,11-17H2,1-2H3,(H,24,26) |
| InChIKey | CVCXZAHQAPPXNX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |