C30H31N3O3 — CID 141193431
4-[1-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]benzimidazol-2-yl]benzoic acid (PubChem CID 141193431) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is 4-[1-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]benzimidazol-2-yl]benzoic acid.
| Compound Name | 4-[1-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]benzimidazol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 141193431 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 4-[1-[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]benzimidazol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nc3ccccc3n2C(CCc2ccccc2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C30H31N3O3/c34-29(31-24-11-5-2-6-12-24)27(20-15-21-9-3-1-4-10-21)33-26-14-8-7-13-25(26)32-28(33)22-16-18-23(19-17-22)30(35)36/h1,3-4,7-10,13-14,16-19,24,27H,2,5-6,11-12,15,20H2,(H,31,34)(H,35,36) |
| InChIKey | LPYLUPWRMFXRTF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |