C34H36F3N3O — CID 68693949
N,2-dicyclohexyl-2-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazol-1-yl]acetamide (PubChem CID 68693949) has the molecular formula C34H36F3N3O and a molecular weight of 559.68 g/mol. Its IUPAC name is N,2-dicyclohexyl-2-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazol-1-yl]acetamide.
| Compound Name | N,2-dicyclohexyl-2-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 68693949 |
| Molecular Formula | C34H36F3N3O |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | N,2-dicyclohexyl-2-[2-[4-[4-(trifluoromethyl)phenyl]phenyl]benzimidazol-1-yl]acetamide |
| SMILES | O=C(NC1CCCCC1)C(C1CCCCC1)n1c(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)nc2ccccc21 |
| InChI | InChI=1S/C34H36F3N3O/c35-34(36,37)27-21-19-24(20-22-27)23-15-17-26(18-16-23)32-39-29-13-7-8-14-30(29)40(32)31(25-9-3-1-4-10-25)33(41)38-28-11-5-2-6-12-28/h7-8,13-22,25,28,31H,1-6,9-12H2,(H,38,41) |
| InChIKey | NKYFOYDQNDGUTR-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |