C28H35N3O3S — CID 68692288
N,2-dicyclohexyl-2-[2-(3-methylsulfonylphenyl)benzimidazol-1-yl]acetamide (PubChem CID 68692288) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is N,2-dicyclohexyl-2-[2-(3-methylsulfonylphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N,2-dicyclohexyl-2-[2-(3-methylsulfonylphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 68692288 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | N,2-dicyclohexyl-2-[2-(3-methylsulfonylphenyl)benzimidazol-1-yl]acetamide |
| SMILES | CS(=O)(=O)c1cccc(-c2nc3ccccc3n2C(C(=O)NC2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C28H35N3O3S/c1-35(33,34)23-16-10-13-21(19-23)27-30-24-17-8-9-18-25(24)31(27)26(20-11-4-2-5-12-20)28(32)29-22-14-6-3-7-15-22/h8-10,13,16-20,22,26H,2-7,11-12,14-15H2,1H3,(H,29,32) |
| InChIKey | PTNZSSDEKQVLFR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |