C30H39N3O2 — CID 68698002
N,2-dicyclohexyl-2-[2-(4-methoxy-3,5-dimethylphenyl)benzimidazol-1-yl]acetamide (PubChem CID 68698002) has the molecular formula C30H39N3O2 and a molecular weight of 473.66 g/mol. Its IUPAC name is N,2-dicyclohexyl-2-[2-(4-methoxy-3,5-dimethylphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N,2-dicyclohexyl-2-[2-(4-methoxy-3,5-dimethylphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 68698002 |
| Molecular Formula | C30H39N3O2 |
| Molecular Weight | 473.66 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | N,2-dicyclohexyl-2-[2-(4-methoxy-3,5-dimethylphenyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1c(C)cc(-c2nc3ccccc3n2C(C(=O)NC2CCCCC2)C2CCCCC2)cc1C |
| InChI | InChI=1S/C30H39N3O2/c1-20-18-23(19-21(2)28(20)35-3)29-32-25-16-10-11-17-26(25)33(29)27(22-12-6-4-7-13-22)30(34)31-24-14-8-5-9-15-24/h10-11,16-19,22,24,27H,4-9,12-15H2,1-3H3,(H,31,34) |
| InChIKey | SONAYFBHZLYSNC-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |