C28H35N3O2 — CID 68694070
N,2-dicyclohexyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide (PubChem CID 68694070) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is N,2-dicyclohexyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide.
| Compound Name | N,2-dicyclohexyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 68694070 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | N,2-dicyclohexyl-2-[2-(4-methoxyphenyl)benzimidazol-1-yl]acetamide |
| SMILES | COc1ccc(-c2nc3ccccc3n2C(C(=O)NC2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H35N3O2/c1-33-23-18-16-21(17-19-23)27-30-24-14-8-9-15-25(24)31(27)26(20-10-4-2-5-11-20)28(32)29-22-12-6-3-7-13-22/h8-9,14-20,22,26H,2-7,10-13H2,1H3,(H,29,32) |
| InChIKey | PKOAQWPCFKEBHS-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |