C28H33N3O5 — CID 68695594
methyl 4-[1-[1-cyclohexyl-2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate (PubChem CID 68695594) has the molecular formula C28H33N3O5 and a molecular weight of 491.59 g/mol. Its IUPAC name is methyl 4-[1-[1-cyclohexyl-2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate.
| Compound Name | methyl 4-[1-[1-cyclohexyl-2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate |
|---|---|
| PubChem CID | 68695594 |
| Molecular Formula | C28H33N3O5 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | methyl 4-[1-[1-cyclohexyl-2-[(4-methoxy-4-oxobutyl)amino]-2-oxoethyl]benzimidazol-2-yl]benzoate |
| SMILES | COC(=O)CCCNC(=O)C(C1CCCCC1)n1c(-c2ccc(C(=O)OC)cc2)nc2ccccc21 |
| InChI | InChI=1S/C28H33N3O5/c1-35-24(32)13-8-18-29-27(33)25(19-9-4-3-5-10-19)31-23-12-7-6-11-22(23)30-26(31)20-14-16-21(17-15-20)28(34)36-2/h6-7,11-12,14-17,19,25H,3-5,8-10,13,18H2,1-2H3,(H,29,33) |
| InChIKey | GGXFWGSWLYSJFQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|