C19H26N2O4 — CID 68669299
methyl 2-(4-butyl-2,3-dioxopiperazin-1-yl)-4-phenylbutanoate (PubChem CID 68669299) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl 2-(4-butyl-2,3-dioxopiperazin-1-yl)-4-phenylbutanoate.
| Compound Name | methyl 2-(4-butyl-2,3-dioxopiperazin-1-yl)-4-phenylbutanoate |
|---|---|
| PubChem CID | 68669299 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | methyl 2-(4-butyl-2,3-dioxopiperazin-1-yl)-4-phenylbutanoate |
| SMILES | CCCCN1CCN(C(CCc2ccccc2)C(=O)OC)C(=O)C1=O |
| InChI | InChI=1S/C19H26N2O4/c1-3-4-12-20-13-14-21(18(23)17(20)22)16(19(24)25-2)11-10-15-8-6-5-7-9-15/h5-9,16H,3-4,10-14H2,1-2H3 |
| InChIKey | YRHLEJZJYUXLTQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|