C20H29NO3 — CID 58608206
methyl 2-[(3R)-3-[(2R)-butan-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-4-phenylbutanoate (PubChem CID 58608206) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is methyl 2-[(3R)-3-[(2R)-butan-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-4-phenylbutanoate.
| Compound Name | methyl 2-[(3R)-3-[(2R)-butan-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-4-phenylbutanoate |
|---|---|
| PubChem CID | 58608206 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | methyl 2-[(3R)-3-[(2R)-butan-2-yl]-3-methyl-2-oxopyrrolidin-1-yl]-4-phenylbutanoate |
| SMILES | CC[C@@H](C)[C@@]1(C)CCN(C(CCc2ccccc2)C(=O)OC)C1=O |
| InChI | InChI=1S/C20H29NO3/c1-5-15(2)20(3)13-14-21(19(20)23)17(18(22)24-4)12-11-16-9-7-6-8-10-16/h6-10,15,17H,5,11-14H2,1-4H3/t15-,17?,20-/m1/s1 |
| InChIKey | RAVGUZNXBFPJIS-QMBUQHDCSA-N |
| XLogP | 3.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |