C21H31NO3 — CID 167239523
benzyl 6-butan-2-yl-1,3,6-trimethyl-7-oxoazepane-3-carboxylate (PubChem CID 167239523) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is benzyl 6-butan-2-yl-1,3,6-trimethyl-7-oxoazepane-3-carboxylate.
| Compound Name | benzyl 6-butan-2-yl-1,3,6-trimethyl-7-oxoazepane-3-carboxylate |
|---|---|
| PubChem CID | 167239523 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | benzyl 6-butan-2-yl-1,3,6-trimethyl-7-oxoazepane-3-carboxylate |
| SMILES | CCC(C)C1(C)CCC(C)(C(=O)OCc2ccccc2)CN(C)C1=O |
| InChI | InChI=1S/C21H31NO3/c1-6-16(2)21(4)13-12-20(3,15-22(5)18(21)23)19(24)25-14-17-10-8-7-9-11-17/h7-11,16H,6,12-15H2,1-5H3 |
| InChIKey | JCUUJPDWFHXQSR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |