C27H44N4O3 — CID 143195539
(2S)-2-[(3S)-3-acetamido-3-[(2S)-butan-2-yl]-2-oxopyrrolidin-1-yl]-N-[3-(butylamino)propyl]-4-phenylbutanamide (PubChem CID 143195539) has the molecular formula C27H44N4O3 and a molecular weight of 472.67 g/mol. Its IUPAC name is (2S)-2-[(3S)-3-acetamido-3-[(2S)-butan-2-yl]-2-oxopyrrolidin-1-yl]-N-[3-(butylamino)propyl]-4-phenylbutanamide.
| Compound Name | (2S)-2-[(3S)-3-acetamido-3-[(2S)-butan-2-yl]-2-oxopyrrolidin-1-yl]-N-[3-(butylamino)propyl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 143195539 |
| Molecular Formula | C27H44N4O3 |
| Molecular Weight | 472.67 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (2S)-2-[(3S)-3-acetamido-3-[(2S)-butan-2-yl]-2-oxopyrrolidin-1-yl]-N-[3-(butylamino)propyl]-4-phenylbutanamide |
| SMILES | CCCCNCCCNC(=O)[C@H](CCc1ccccc1)N1CC[C@](NC(C)=O)([C@@H](C)CC)C1=O |
| InChI | InChI=1S/C27H44N4O3/c1-5-7-17-28-18-11-19-29-25(33)24(15-14-23-12-9-8-10-13-23)31-20-16-27(26(31)34,21(3)6-2)30-22(4)32/h8-10,12-13,21,24,28H,5-7,11,14-20H2,1-4H3,(H,29,33)(H,30,32)/t21-,24-,27-/m0/s1 |
| InChIKey | CNLUWPQXTKJOBQ-DDZLNHKNSA-N |
| XLogP | 3.04 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.67 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|