C21H31N3O4 — CID 57029258
(2R)-2-[(3S)-3-[2-(hydroxyamino)-2-oxoethyl]-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]-N-methyl-4-phenylbutanamide (PubChem CID 57029258) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-[2-(hydroxyamino)-2-oxoethyl]-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]-N-methyl-4-phenylbutanamide.
| Compound Name | (2R)-2-[(3S)-3-[2-(hydroxyamino)-2-oxoethyl]-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]-N-methyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 57029258 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | (2R)-2-[(3S)-3-[2-(hydroxyamino)-2-oxoethyl]-3-(2-methylpropyl)-2-oxopyrrolidin-1-yl]-N-methyl-4-phenylbutanamide |
| SMILES | CNC(=O)C(CCc1ccccc1)N1CC[C@](CC(=O)NO)(CC(C)C)C1=O |
| InChI | InChI=1S/C21H31N3O4/c1-15(2)13-21(14-18(25)23-28)11-12-24(20(21)27)17(19(26)22-3)10-9-16-7-5-4-6-8-16/h4-8,15,17,28H,9-14H2,1-3H3,(H,22,26)(H,23,25)/t17?,21-/m1/s1 |
| InChIKey | MLKMGASHHNOSHZ-FBLFFUNLSA-N |
| XLogP | 1.89 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|