C33H39N3O4 — CID 19705571
N-[4-(hydroxyamino)-3-[3-(2-methylpropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]-4-phenylbenzamide (PubChem CID 19705571) has the molecular formula C33H39N3O4 and a molecular weight of 541.69 g/mol. Its IUPAC name is N-[4-(hydroxyamino)-3-[3-(2-methylpropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]-4-phenylbenzamide.
| Compound Name | N-[4-(hydroxyamino)-3-[3-(2-methylpropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 19705571 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | N-[4-(hydroxyamino)-3-[3-(2-methylpropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]-4-phenylbenzamide |
| SMILES | CC(C)CC1(C(CCNC(=O)c2ccc(-c3ccccc3)cc2)C(=O)NO)CCN(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C33H39N3O4/c1-24(2)23-33(19-22-36(32(33)39)21-18-25-9-5-3-6-10-25)29(31(38)35-40)17-20-34-30(37)28-15-13-27(14-16-28)26-11-7-4-8-12-26/h3-16,24,29,40H,17-23H2,1-2H3,(H,34,37)(H,35,38) |
| InChIKey | PPOSGUXYPXJTOD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|