C26H32FN3O5 — CID 54187029
3-fluoro-N-[4-(hydroxyamino)-3-[3-(3-hydroxypropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]benzamide (PubChem CID 54187029) has the molecular formula C26H32FN3O5 and a molecular weight of 485.56 g/mol. Its IUPAC name is 3-fluoro-N-[4-(hydroxyamino)-3-[3-(3-hydroxypropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]benzamide.
| Compound Name | 3-fluoro-N-[4-(hydroxyamino)-3-[3-(3-hydroxypropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 54187029 |
| Molecular Formula | C26H32FN3O5 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | 3-fluoro-N-[4-(hydroxyamino)-3-[3-(3-hydroxypropyl)-2-oxo-1-(2-phenylethyl)pyrrolidin-3-yl]-4-oxobutyl]benzamide |
| SMILES | O=C(NCCC(C(=O)NO)C1(CCCO)CCN(CCc2ccccc2)C1=O)c1cccc(F)c1 |
| InChI | InChI=1S/C26H32FN3O5/c27-21-9-4-8-20(18-21)23(32)28-14-10-22(24(33)29-35)26(12-5-17-31)13-16-30(25(26)34)15-11-19-6-2-1-3-7-19/h1-4,6-9,18,22,31,35H,5,10-17H2,(H,28,32)(H,29,33) |
| InChIKey | PFUISUBJWBYUDJ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|