C19H23ClFN3O2 — CID 119323433
N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]-3-fluorobenzamide;hydrochloride (PubChem CID 119323433) has the molecular formula C19H23ClFN3O2 and a molecular weight of 379.86 g/mol. Its IUPAC name is N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]-3-fluorobenzamide;hydrochloride.
| Compound Name | N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]-3-fluorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119323433 |
| Molecular Formula | C19H23ClFN3O2 |
| Molecular Weight | 379.86 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]propyl]-3-fluorobenzamide;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)C(=O)NCCCNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H22FN3O2.ClH/c20-16-9-4-8-15(13-16)18(24)22-10-5-11-23-19(25)17(21)12-14-6-2-1-3-7-14;/h1-4,6-9,13,17H,5,10-12,21H2,(H,22,24)(H,23,25);1H/t17-;/m0./s1 |
| InChIKey | XBYTURQGEPSPPS-LMOVPXPDSA-N |
| XLogP | 2.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.86 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|