C19H24ClN3O2 — CID 119299589
N-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyl]-4-methylbenzamide;hydrochloride (PubChem CID 119299589) has the molecular formula C19H24ClN3O2 and a molecular weight of 361.87 g/mol. Its IUPAC name is N-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyl]-4-methylbenzamide;hydrochloride.
| Compound Name | N-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyl]-4-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119299589 |
| Molecular Formula | C19H24ClN3O2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N-[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethyl]-4-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)[C@@H](N)Cc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C19H23N3O2.ClH/c1-14-7-9-16(10-8-14)18(23)21-11-12-22-19(24)17(20)13-15-5-3-2-4-6-15;/h2-10,17H,11-13,20H2,1H3,(H,21,23)(H,22,24);1H/t17-;/m0./s1 |
| InChIKey | HGVJASNXJVOKCK-LMOVPXPDSA-N |
| XLogP | 1.83 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|