C23H24ClN3O2 — CID 154890074
N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-4-methylbenzamide;hydrochloride (PubChem CID 154890074) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-4-methylbenzamide;hydrochloride.
| Compound Name | N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-4-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 154890074 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[3-[[(2S)-2-amino-3-phenylpropanoyl]amino]phenyl]-4-methylbenzamide;hydrochloride |
| SMILES | Cc1ccc(C(=O)Nc2cccc(NC(=O)[C@@H](N)Cc3ccccc3)c2)cc1.Cl |
| InChI | InChI=1S/C23H23N3O2.ClH/c1-16-10-12-18(13-11-16)22(27)25-19-8-5-9-20(15-19)26-23(28)21(24)14-17-6-3-2-4-7-17;/h2-13,15,21H,14,24H2,1H3,(H,25,27)(H,26,28);1H/t21-;/m0./s1 |
| InChIKey | JAIIKIPKRRQAGT-BOXHHOBZSA-N |
| XLogP | 4.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |