C15H22FN3O2 — CID 120562623
N-[3-(4-aminopentanoylamino)propyl]-3-fluorobenzamide (PubChem CID 120562623) has the molecular formula C15H22FN3O2 and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[3-(4-aminopentanoylamino)propyl]-3-fluorobenzamide.
| Compound Name | N-[3-(4-aminopentanoylamino)propyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 120562623 |
| Molecular Formula | C15H22FN3O2 |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-[3-(4-aminopentanoylamino)propyl]-3-fluorobenzamide |
| SMILES | CC(N)CCC(=O)NCCCNC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C15H22FN3O2/c1-11(17)6-7-14(20)18-8-3-9-19-15(21)12-4-2-5-13(16)10-12/h2,4-5,10-11H,3,6-9,17H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | XLDNQEQAPLZOKR-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|