C14H18N4O3 — CID 63574106
2-(4-ethyl-2,3-dioxopiperazin-1-yl)-2-phenylacetohydrazide (PubChem CID 63574106) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-2-phenylacetohydrazide.
| Compound Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 63574106 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(4-ethyl-2,3-dioxopiperazin-1-yl)-2-phenylacetohydrazide |
| SMILES | CCN1CCN(C(C(=O)NN)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C14H18N4O3/c1-2-17-8-9-18(14(21)13(17)20)11(12(19)16-15)10-6-4-3-5-7-10/h3-7,11H,2,8-9,15H2,1H3,(H,16,19) |
| InChIKey | PXTHYIJZMRUORP-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|