C21H25N5O3 — CID 70751435
2-(4-butyl-2,3-dioxopiperazin-1-yl)-2-phenyl-N-(pyrimidin-4-ylmethyl)acetamide (PubChem CID 70751435) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 2-(4-butyl-2,3-dioxopiperazin-1-yl)-2-phenyl-N-(pyrimidin-4-ylmethyl)acetamide.
| Compound Name | 2-(4-butyl-2,3-dioxopiperazin-1-yl)-2-phenyl-N-(pyrimidin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 70751435 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-(4-butyl-2,3-dioxopiperazin-1-yl)-2-phenyl-N-(pyrimidin-4-ylmethyl)acetamide |
| SMILES | CCCCN1CCN(C(C(=O)NCc2ccncn2)c2ccccc2)C(=O)C1=O |
| InChI | InChI=1S/C21H25N5O3/c1-2-3-11-25-12-13-26(21(29)20(25)28)18(16-7-5-4-6-8-16)19(27)23-14-17-9-10-22-15-24-17/h4-10,15,18H,2-3,11-14H2,1H3,(H,23,27) |
| InChIKey | YIFFGBNQEGESGY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|