C12H12N2O4 — CID 64955374
1-(1,3-benzodioxol-5-ylmethyl)piperazine-2,5-dione (PubChem CID 64955374) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)piperazine-2,5-dione.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 64955374 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1CN(Cc2ccc3c(c2)OCO3)C(=O)CN1 |
| InChI | InChI=1S/C12H12N2O4/c15-11-6-14(12(16)4-13-11)5-8-1-2-9-10(3-8)18-7-17-9/h1-3H,4-7H2,(H,13,15) |
| InChIKey | GWEGHMYPQMKJSV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |