C14H18N2O3 — CID 117013566
4-(1,3-benzodioxol-5-ylmethyl)-1-ethylpiperazin-2-one (PubChem CID 117013566) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-1-ethylpiperazin-2-one.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-1-ethylpiperazin-2-one |
|---|---|
| PubChem CID | 117013566 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-1-ethylpiperazin-2-one |
| SMILES | CCN1CCN(Cc2ccc3c(c2)OCO3)CC1=O |
| InChI | InChI=1S/C14H18N2O3/c1-2-16-6-5-15(9-14(16)17)8-11-3-4-12-13(7-11)19-10-18-12/h3-4,7H,2,5-6,8-10H2,1H3 |
| InChIKey | BFQAGAORHXXYJB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |