C21H12BrN5O3 — CID 168609656
2-[[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]amino]ethene-1,1,2-tricarbonitrile (PubChem CID 168609656) has the molecular formula C21H12BrN5O3 and a molecular weight of 462.26 g/mol. Its IUPAC name is 2-[[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]amino]ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-[[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]amino]ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 168609656 |
| Molecular Formula | C21H12BrN5O3 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | 2-[[2-(1,3-benzodioxol-5-ylmethyl)-7-bromo-3-oxo-1H-isoindol-5-yl]amino]ethene-1,1,2-tricarbonitrile |
| SMILES | N#CC(C#N)=C(C#N)Nc1cc(Br)c2c(c1)C(=O)N(Cc1ccc3c(c1)OCO3)C2 |
| InChI | InChI=1S/C21H12BrN5O3/c22-17-5-14(26-18(8-25)13(6-23)7-24)4-15-16(17)10-27(21(15)28)9-12-1-2-19-20(3-12)30-11-29-19/h1-5,26H,9-11H2 |
| InChIKey | NSBWLRJMTSPSIB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 122.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|