C16H12N2O5 — CID 11849968
7-[(3-nitrophenyl)methyl]-8H-[1,3]dioxolo[4,5-e]isoindol-6-one (PubChem CID 11849968) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is 7-[(3-nitrophenyl)methyl]-8H-[1,3]dioxolo[4,5-e]isoindol-6-one.
| Compound Name | 7-[(3-nitrophenyl)methyl]-8H-[1,3]dioxolo[4,5-e]isoindol-6-one |
|---|---|
| PubChem CID | 11849968 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 7-[(3-nitrophenyl)methyl]-8H-[1,3]dioxolo[4,5-e]isoindol-6-one |
| SMILES | O=C1c2ccc3c(c2CN1Cc1cccc([N+](=O)[O-])c1)OCO3 |
| InChI | InChI=1S/C16H12N2O5/c19-16-12-4-5-14-15(23-9-22-14)13(12)8-17(16)7-10-2-1-3-11(6-10)18(20)21/h1-6H,7-9H2 |
| InChIKey | ZGWWWDCCDAMZSQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|