C10H10N6O — CID 168604976
2-(2-cyano-4-formylphenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168604976) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(2-cyano-4-formylphenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(2-cyano-4-formylphenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604976 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 2-(2-cyano-4-formylphenyl)-1-(diaminomethylidene)guanidine |
| SMILES | N#Cc1cc(C=O)ccc1/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C10H10N6O/c11-4-7-3-6(5-17)1-2-8(7)15-10(14)16-9(12)13/h1-3,5H,(H6,12,13,14,15,16) |
| InChIKey | MPRINONAPKPBBU-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|