C12H12N4O3 — CID 114063273
2-(N-(2-amino-2-oxoethyl)-2-cyano-4-formylanilino)acetamide (PubChem CID 114063273) has the molecular formula C12H12N4O3 and a molecular weight of 260.25 g/mol. Its IUPAC name is 2-(N-(2-amino-2-oxoethyl)-2-cyano-4-formylanilino)acetamide.
| Compound Name | 2-(N-(2-amino-2-oxoethyl)-2-cyano-4-formylanilino)acetamide |
|---|---|
| PubChem CID | 114063273 |
| Molecular Formula | C12H12N4O3 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 2-(N-(2-amino-2-oxoethyl)-2-cyano-4-formylanilino)acetamide |
| SMILES | N#Cc1cc(C=O)ccc1N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C12H12N4O3/c13-4-9-3-8(7-17)1-2-10(9)16(5-11(14)18)6-12(15)19/h1-3,7H,5-6H2,(H2,14,18)(H2,15,19) |
| InChIKey | UOMNCPNEAJSNBX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 130.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|