C9H10N6 — CID 168591340
2-[(4-amino-3-cyanophenyl)methylideneamino]guanidine (PubChem CID 168591340) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-[(4-amino-3-cyanophenyl)methylideneamino]guanidine.
| Compound Name | 2-[(4-amino-3-cyanophenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591340 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[(4-amino-3-cyanophenyl)methylideneamino]guanidine |
| SMILES | N#Cc1cc(C=NN=C(N)N)ccc1N |
| InChI | InChI=1S/C9H10N6/c10-4-7-3-6(1-2-8(7)11)5-14-15-9(12)13/h1-3,5H,11H2,(H4,12,13,15) |
| InChIKey | QUBGNYZGUFIDHS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|