About [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea
[[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea (PubChem CID 168535084) has the molecular formula C12H15N3O2S
and a molecular weight of 265.34 g/mol. Its IUPAC name is [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea.
Molecular Properties
| Compound Name | [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea |
| PubChem CID | 168535084 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccccc1C1OCCCO1 |
| InChI | InChI=1S/C12H15N3O2S/c13-12(18)15-14-8-9-4-1-2-5-10(9)11-16-6-3-7-17-11/h1-2,4-5,8,11H,3,6-7H2,(H3,13,15,18) |
| InChIKey | IPSYMWDQYBQVKN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea?
The IUPAC name of [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea (CID 168535084) is [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea.
What is the SMILES notation for [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea?
The canonical SMILES for [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea is NC(=S)NN=Cc1ccccc1C1OCCCO1.
What is the InChIKey of [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea?
The InChIKey is IPSYMWDQYBQVKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2S/c13-12(18)15-14-8-9-4-1-2-5-10(9)11-16-6-3-7-17-11/h1-2,4-5,8,11H,3,6-7H2,(H3,13,15,18).
What are the key properties of [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea?
[[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea has a molecular weight of 265.34 g/mol, XLogP of 1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(1,3-dioxan-2-yl)phenyl]methylideneamino]thiourea is sourced from PubChem (CID 168535084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).