C26H27NO3Si — CID 58230610
1-[4-[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone (PubChem CID 58230610) has the molecular formula C26H27NO3Si and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[4-[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone.
| Compound Name | 1-[4-[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 58230610 |
| Molecular Formula | C26H27NO3Si |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 1-[4-[6-(2-trimethylsilylethynyl)-1,3-benzodioxol-5-yl]-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C1C=CCC1C(c1cc3c(cc1C#C[Si](C)(C)C)OCO3)N2 |
| InChI | InChI=1S/C26H27NO3Si/c1-16(28)17-8-9-23-22(12-17)19-6-5-7-20(19)26(27-23)21-14-25-24(29-15-30-25)13-18(21)10-11-31(2,3)4/h5-6,8-9,12-14,19-20,26-27H,7,15H2,1-4H3 |
| InChIKey | GRSTUDUCTBJKFM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|