C9H10Cl2N2Si — CID 170916693
2-(3,6-dichloropyridazin-4-yl)ethynyl-trimethylsilane (PubChem CID 170916693) has the molecular formula C9H10Cl2N2Si and a molecular weight of 245.19 g/mol. Its IUPAC name is 2-(3,6-dichloropyridazin-4-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(3,6-dichloropyridazin-4-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 170916693 |
| Molecular Formula | C9H10Cl2N2Si |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 244.00 |
| IUPAC Name | 2-(3,6-dichloropyridazin-4-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1cc(Cl)nnc1Cl |
| InChI | InChI=1S/C9H10Cl2N2Si/c1-14(2,3)5-4-7-6-8(10)12-13-9(7)11/h6H,1-3H3 |
| InChIKey | SGMGTADBZOREKP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|