C14H18O3Si — CID 166442917
[6-(3-trimethylsilylprop-1-ynyl)-1,3-benzodioxol-5-yl]methanol (PubChem CID 166442917) has the molecular formula C14H18O3Si and a molecular weight of 262.38 g/mol. Its IUPAC name is [6-(3-trimethylsilylprop-1-ynyl)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [6-(3-trimethylsilylprop-1-ynyl)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 166442917 |
| Molecular Formula | C14H18O3Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [6-(3-trimethylsilylprop-1-ynyl)-1,3-benzodioxol-5-yl]methanol |
| SMILES | C[Si](C)(C)CC#Cc1cc2c(cc1CO)OCO2 |
| InChI | InChI=1S/C14H18O3Si/c1-18(2,3)6-4-5-11-7-13-14(17-10-16-13)8-12(11)9-15/h7-8,15H,6,9-10H2,1-3H3 |
| InChIKey | SSWASJJXCYJJIR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|