C15H16O3 — CID 134884648
1-(6-hex-1-ynyl-1,3-benzodioxol-5-yl)ethanone (PubChem CID 134884648) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-(6-hex-1-ynyl-1,3-benzodioxol-5-yl)ethanone.
| Compound Name | 1-(6-hex-1-ynyl-1,3-benzodioxol-5-yl)ethanone |
|---|---|
| PubChem CID | 134884648 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-(6-hex-1-ynyl-1,3-benzodioxol-5-yl)ethanone |
| SMILES | CCCCC#Cc1cc2c(cc1C(C)=O)OCO2 |
| InChI | InChI=1S/C15H16O3/c1-3-4-5-6-7-12-8-14-15(18-10-17-14)9-13(12)11(2)16/h8-9H,3-5,10H2,1-2H3 |
| InChIKey | WFDLHLCAJJHRRY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|