C14H10Br2O2 — CID 170457212
5-(4-bromobut-1-ynyl)-6-(3-bromoprop-1-ynyl)-1,3-benzodioxole (PubChem CID 170457212) has the molecular formula C14H10Br2O2 and a molecular weight of 370.04 g/mol. Its IUPAC name is 5-(4-bromobut-1-ynyl)-6-(3-bromoprop-1-ynyl)-1,3-benzodioxole.
| Compound Name | 5-(4-bromobut-1-ynyl)-6-(3-bromoprop-1-ynyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 170457212 |
| Molecular Formula | C14H10Br2O2 |
| Molecular Weight | 370.04 g/mol |
| Exact Mass | 367.90 |
| IUPAC Name | 5-(4-bromobut-1-ynyl)-6-(3-bromoprop-1-ynyl)-1,3-benzodioxole |
| SMILES | BrCC#Cc1cc2c(cc1C#CCCBr)OCO2 |
| InChI | InChI=1S/C14H10Br2O2/c15-6-2-1-4-11-8-13-14(18-10-17-13)9-12(11)5-3-7-16/h8-9H,2,6-7,10H2 |
| InChIKey | HZRNRYWISWBVMN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.04 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|