C22H17BrO4 — CID 170457269
methyl 4-[2-[7-(4-bromobut-1-ynyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethynyl]benzoate (PubChem CID 170457269) has the molecular formula C22H17BrO4 and a molecular weight of 425.28 g/mol. Its IUPAC name is methyl 4-[2-[7-(4-bromobut-1-ynyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethynyl]benzoate.
| Compound Name | methyl 4-[2-[7-(4-bromobut-1-ynyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 170457269 |
| Molecular Formula | C22H17BrO4 |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | methyl 4-[2-[7-(4-bromobut-1-ynyl)-2,3-dihydro-1,4-benzodioxin-6-yl]ethynyl]benzoate |
| SMILES | COC(=O)c1ccc(C#Cc2cc3c(cc2C#CCCBr)OCCO3)cc1 |
| InChI | InChI=1S/C22H17BrO4/c1-25-22(24)17-8-5-16(6-9-17)7-10-19-15-21-20(26-12-13-27-21)14-18(19)4-2-3-11-23/h5-6,8-9,14-15H,3,11-13H2,1H3 |
| InChIKey | IWXSOQOEUUZBMT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|