C12H9NO4 — CID 170473770
4-(6-formyl-1,3-benzodioxol-5-yl)but-3-ynamide (PubChem CID 170473770) has the molecular formula C12H9NO4 and a molecular weight of 231.21 g/mol. Its IUPAC name is 4-(6-formyl-1,3-benzodioxol-5-yl)but-3-ynamide.
| Compound Name | 4-(6-formyl-1,3-benzodioxol-5-yl)but-3-ynamide |
|---|---|
| PubChem CID | 170473770 |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 4-(6-formyl-1,3-benzodioxol-5-yl)but-3-ynamide |
| SMILES | NC(=O)CC#Cc1cc2c(cc1C=O)OCO2 |
| InChI | InChI=1S/C12H9NO4/c13-12(15)3-1-2-8-4-10-11(17-7-16-10)5-9(8)6-14/h4-6H,3,7H2,(H2,13,15) |
| InChIKey | GRKAKMAKBSVMMY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|