C19H31NO4 — CID 143720768
ethane;5-(6-methoxy-1,3-benzodioxol-5-yl)pent-4-yn-1-ol;N-methylpropan-1-amine (PubChem CID 143720768) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is ethane;5-(6-methoxy-1,3-benzodioxol-5-yl)pent-4-yn-1-ol;N-methylpropan-1-amine.
| Compound Name | ethane;5-(6-methoxy-1,3-benzodioxol-5-yl)pent-4-yn-1-ol;N-methylpropan-1-amine |
|---|---|
| PubChem CID | 143720768 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | ethane;5-(6-methoxy-1,3-benzodioxol-5-yl)pent-4-yn-1-ol;N-methylpropan-1-amine |
| SMILES | CC.CCCNC.COc1cc2c(cc1C#CCCCO)OCO2 |
| InChI | InChI=1S/C13H14O4.C4H11N.C2H6/c1-15-11-8-13-12(16-9-17-13)7-10(11)5-3-2-4-6-14;1-3-4-5-2;1-2/h7-8,14H,2,4,6,9H2,1H3;5H,3-4H2,1-2H3;1-2H3 |
| InChIKey | BXJHHILUBXHAPZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|