C15H17NO3 — CID 10825173
N-(1,3-benzodioxol-5-yl)oct-2-ynamide (PubChem CID 10825173) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)oct-2-ynamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)oct-2-ynamide |
|---|---|
| PubChem CID | 10825173 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)oct-2-ynamide |
| SMILES | CCCCCC#CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H17NO3/c1-2-3-4-5-6-7-15(17)16-12-8-9-13-14(10-12)19-11-18-13/h8-10H,2-5,11H2,1H3,(H,16,17) |
| InChIKey | IFHMRCNKXMSXFJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|