C14H20N2O3 — CID 109006084
2-(1,3-benzodioxol-5-ylamino)-N-pentylacetamide (PubChem CID 109006084) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-pentylacetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-pentylacetamide |
|---|---|
| PubChem CID | 109006084 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CNc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-2-3-4-7-15-14(17)9-16-11-5-6-12-13(8-11)19-10-18-12/h5-6,8,16H,2-4,7,9-10H2,1H3,(H,15,17) |
| InChIKey | ZZLNOBUQRQXIBL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|