C13H16O4 — CID 66045725
[6-(2-methylidenebutoxy)-1,3-benzodioxol-5-yl]methanol (PubChem CID 66045725) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [6-(2-methylidenebutoxy)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [6-(2-methylidenebutoxy)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 66045725 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [6-(2-methylidenebutoxy)-1,3-benzodioxol-5-yl]methanol |
| SMILES | C=C(CC)COc1cc2c(cc1CO)OCO2 |
| InChI | InChI=1S/C13H16O4/c1-3-9(2)7-15-11-5-13-12(16-8-17-13)4-10(11)6-14/h4-5,14H,2-3,6-8H2,1H3 |
| InChIKey | PFJSKLNPPPZFBU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|