C12H14O5 — CID 63558987
[6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol (PubChem CID 63558987) has the molecular formula C12H14O5 and a molecular weight of 238.24 g/mol. Its IUPAC name is [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 63558987 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol |
| SMILES | OCc1cc2c(cc1OC1CCOC1)OCO2 |
| InChI | InChI=1S/C12H14O5/c13-5-8-3-11-12(16-7-15-11)4-10(8)17-9-1-2-14-6-9/h3-4,9,13H,1-2,5-7H2 |
| InChIKey | PPOMAMUSCMTPRZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |