About [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol
[6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol (PubChem CID 63558987) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol.
Molecular Properties
| Compound Name | [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol |
| PubChem CID | 63558987 |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol |
| SMILES | OCc1cc2c(cc1OC1CCOC1)OCO2 |
| InChI | InChI=1S/C12H14O5/c13-5-8-3-11-12(16-7-15-11)4-10(8)17-9-1-2-14-6-9/h3-4,9,13H,1-2,5-7H2 |
| InChIKey | PPOMAMUSCMTPRZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol?
The IUPAC name of [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol (CID 63558987) is [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol.
What is the SMILES notation for [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol?
The canonical SMILES for [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol is OCc1cc2c(cc1OC1CCOC1)OCO2.
What is the InChIKey of [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol?
The InChIKey is PPOMAMUSCMTPRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c13-5-8-3-11-12(16-7-15-11)4-10(8)17-9-1-2-14-6-9/h3-4,9,13H,1-2,5-7H2.
What are the key properties of [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol?
[6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol has a molecular weight of 238.24 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(oxolan-3-yloxy)-1,3-benzodioxol-5-yl]methanol is sourced from PubChem (CID 63558987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).