C15H20O4 — CID 55012960
[6-(cyclohexylmethoxy)-1,3-benzodioxol-5-yl]methanol (PubChem CID 55012960) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is [6-(cyclohexylmethoxy)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [6-(cyclohexylmethoxy)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 55012960 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | [6-(cyclohexylmethoxy)-1,3-benzodioxol-5-yl]methanol |
| SMILES | OCc1cc2c(cc1OCC1CCCCC1)OCO2 |
| InChI | InChI=1S/C15H20O4/c16-8-12-6-14-15(19-10-18-14)7-13(12)17-9-11-4-2-1-3-5-11/h6-7,11,16H,1-5,8-10H2 |
| InChIKey | RLFNYCWXGZUUKD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |