C13H14N2O4 — CID 55013145
[6-(2-pyrazol-1-ylethoxy)-1,3-benzodioxol-5-yl]methanol (PubChem CID 55013145) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is [6-(2-pyrazol-1-ylethoxy)-1,3-benzodioxol-5-yl]methanol.
| Compound Name | [6-(2-pyrazol-1-ylethoxy)-1,3-benzodioxol-5-yl]methanol |
|---|---|
| PubChem CID | 55013145 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [6-(2-pyrazol-1-ylethoxy)-1,3-benzodioxol-5-yl]methanol |
| SMILES | OCc1cc2c(cc1OCCn1cccn1)OCO2 |
| InChI | InChI=1S/C13H14N2O4/c16-8-10-6-12-13(19-9-18-12)7-11(10)17-5-4-15-3-1-2-14-15/h1-3,6-7,16H,4-5,8-9H2 |
| InChIKey | SIWZJRPXGMXHGI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |