C11H13NO3 — CID 88782471
(NZ)-N-[(6-propyl-1,3-benzodioxol-5-yl)methylidene]hydroxylamine (PubChem CID 88782471) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (NZ)-N-[(6-propyl-1,3-benzodioxol-5-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(6-propyl-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 88782471 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (NZ)-N-[(6-propyl-1,3-benzodioxol-5-yl)methylidene]hydroxylamine |
| SMILES | CCCc1cc2c(cc1/C=N\O)OCO2 |
| InChI | InChI=1S/C11H13NO3/c1-2-3-8-4-10-11(15-7-14-10)5-9(8)6-12-13/h4-6,13H,2-3,7H2,1H3/b12-6- |
| InChIKey | ACIYCDFNNVUFIN-SDQBBNPISA-N |
| XLogP | 2.18 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|