C21H25ClO4 — CID 163613157
5-(chloromethyl)-6-propyl-1,3-benzodioxole;5-propyl-1,3-benzodioxole (PubChem CID 163613157) has the molecular formula C21H25ClO4 and a molecular weight of 376.88 g/mol. Its IUPAC name is 5-(chloromethyl)-6-propyl-1,3-benzodioxole;5-propyl-1,3-benzodioxole.
| Compound Name | 5-(chloromethyl)-6-propyl-1,3-benzodioxole;5-propyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 163613157 |
| Molecular Formula | C21H25ClO4 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-(chloromethyl)-6-propyl-1,3-benzodioxole;5-propyl-1,3-benzodioxole |
| SMILES | CCCc1cc2c(cc1CCl)OCO2.CCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13ClO2.C10H12O2/c1-2-3-8-4-10-11(14-7-13-10)5-9(8)6-12;1-2-3-8-4-5-9-10(6-8)12-7-11-9/h4-5H,2-3,6-7H2,1H3;4-6H,2-3,7H2,1H3 |
| InChIKey | HHRMNIZOYXRFMQ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|