C17H18O2 — CID 123726273
3-propyl-6,11-dihydrobenzo[c][1,6]benzodioxocine (PubChem CID 123726273) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-propyl-6,11-dihydrobenzo[c][1,6]benzodioxocine.
| Compound Name | 3-propyl-6,11-dihydrobenzo[c][1,6]benzodioxocine |
|---|---|
| PubChem CID | 123726273 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-propyl-6,11-dihydrobenzo[c][1,6]benzodioxocine |
| SMILES | CCCc1ccc2c(c1)OCc1ccccc1CO2 |
| InChI | InChI=1S/C17H18O2/c1-2-5-13-8-9-16-17(10-13)19-12-15-7-4-3-6-14(15)11-18-16/h3-4,6-10H,2,5,11-12H2,1H3 |
| InChIKey | IIVFYMCPWYOEIC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |