C14H20O3 — CID 91665385
5-(propoxymethyl)-6-propyl-1,3-benzodioxole (PubChem CID 91665385) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-(propoxymethyl)-6-propyl-1,3-benzodioxole.
| Compound Name | 5-(propoxymethyl)-6-propyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 91665385 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 5-(propoxymethyl)-6-propyl-1,3-benzodioxole |
| SMILES | CCCOCc1cc2c(cc1CCC)OCO2 |
| InChI | InChI=1S/C14H20O3/c1-3-5-11-7-13-14(17-10-16-13)8-12(11)9-15-6-4-2/h7-8H,3-6,9-10H2,1-2H3 |
| InChIKey | PTLAAXYWSXQILW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|